175135-54-3 Usage
Uses
Used in Pharmaceutical Industry:
1-(2,5-DICHLORO-4-NITROPHENYL)-1H-PYRROLE is used as a synthetic intermediate for the development of new pharmaceutical compounds. Its unique structure allows for the creation of diverse organic molecules with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(2,5-DICHLORO-4-NITROPHENYL)-1H-PYRROLE is utilized as a precursor in the synthesis of various agrochemicals. Its properties can contribute to the development of new pesticides or other agricultural chemicals that can improve crop protection and yield.
Used in Chemical Research:
1-(2,5-DICHLORO-4-NITROPHENYL)-1H-PYRROLE is also used as a research compound in chemical laboratories. Its reactivity and structural features make it a valuable tool for studying chemical reactions and exploring new synthetic pathways.
Used in Material Science:
1-(2,5-DICHLORO-4-NITROPHENYL)-1H-PYRROLE's unique properties can be leveraged in material science for the development of new materials with specific characteristics, such as improved stability or reactivity, which can be applied in various industrial processes.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-54-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175135-54:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*5)+(1*4)=133
133 % 10 = 3
So 175135-54-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H6Cl2N2O2/c11-7-6-10(14(15)16)8(12)5-9(7)13-3-1-2-4-13/h1-6H
