175135-66-7 Usage
General Description
3-AMINO-2-(2-FLUOROPHENOXY)PYRIDINE is a chemical compound with the molecular formula C11H9FN2O. It is a pyridine derivative that contains an amino group and a fluorophenyl group attached to the pyridine ring. 3-AMINO-2-(2-FLUOROPHENOXY)PYRIDINE has potential applications in medicinal chemistry, particularly in the development of pharmaceutical drugs. Its unique structure and properties make it a valuable building block for synthesizing new molecules with potential therapeutic effects. Furthermore, its fluorine-containing group makes it of interest in the field of fluorine chemistry, where compounds with fluorine atoms are used for various applications in materials science, drug design, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-66-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175135-66:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*6)+(1*6)=137
137 % 10 = 7
So 175135-66-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H12F2N2O2/c1-3-19-13(18)10-7-16-17(8(10)2)12-5-4-9(14)6-11(12)15/h4-7H,3H2,1-2H3