175135-82-7 Usage
Uses
Used in Medicinal Chemistry:
2-[(4-CHLOROPHENYL)THIO]NICOTINAMIDE is used as a building block for the synthesis of novel pharmaceuticals due to its unique structural features and potential biological activity.
Used in Pharmaceutical Research:
As a nicotinamide derivative, 2-[(4-CHLOROPHENYL)THIO]NICOTINAMIDE is used in pharmaceutical research for its potential antioxidant and anti-inflammatory properties, which may be beneficial in the development of treatments for various diseases.
Used in Drug Design:
2-[(4-CHLOROPHENYL)THIO]NICOTINAMIDE's hydrophobic nature, conferred by the chlorophenyl group, makes 2-[(4-CHLOROPHENYL)THIO]NICOTINAMIDE a candidate for drug design, particularly for targeting specific biological pathways that require hydrophobic interactions.
Further research is necessary to fully explore the properties and potential applications of 2-[(4-CHLOROPHENYL)THIO]NICOTINAMIDE in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-82-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175135-82:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*8)+(1*2)=137
137 % 10 = 7
So 175135-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H9ClN2OS/c13-8-3-5-9(6-4-8)17-12-10(11(14)16)2-1-7-15-12/h1-7H,(H2,14,16)
