175135-84-9 Usage
Uses
Used in Pharmaceutical Research:
4-CHLORO-2-(3,5-DICHLOROPHENYL)-5-(1-METHYLHYDRAZINO)-2,3-DIHYDROPYRIDAZIN-3-ONE is used as a research compound for exploring its potential medicinal properties, particularly in the areas of anti-cancer and anti-inflammatory therapies. Its unique chemical structure and functional groups may contribute to its biological activity, warranting further investigation into its therapeutic potential.
Used in Drug Development:
In the pharmaceutical industry, 4-CHLORO-2-(3,5-DICHLOROPHENYL)-5-(1-METHYLHYDRAZINO)-2,3-DIHYDROPYRIDAZIN-3-ONE is utilized as a starting point for the development of new drugs. Its potential as an anti-cancer and anti-inflammatory agent makes it a valuable asset in the search for novel therapeutic agents. Further research and testing are required to fully understand its properties and optimize its use in drug formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-84-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175135-84:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*8)+(1*4)=139
139 % 10 = 9
So 175135-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H9Cl3N4O/c1-17(15)9-5-16-18(11(19)10(9)14)8-3-6(12)2-7(13)4-8/h2-5H,15H2,1H3
