175135-84-9 Usage
General Description
4-CHLORO-2-(3,5-DICHLOROPHENYL)-5-(1-METHYLHYDRAZINO)-2,3-DIHYDROPYRIDAZIN-3-ONE is a chemical compound that belongs to the dihydropyridazine class. It contains a chloro and dichlorophenyl substituents as well as a methylhydrazino group, making it a highly functionalized molecule. Dihydropyridazines have been studied for their potential medicinal properties, including as anti-cancer and anti-inflammatory agents. This particular compound may have potential applications in drug development and pharmaceutical research due to its unique chemical structure and potential biological activity. However, further research and testing are necessary to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-84-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175135-84:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*8)+(1*4)=139
139 % 10 = 9
So 175135-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H9Cl3N4O/c1-17(15)9-5-16-18(11(19)10(9)14)8-3-6(12)2-7(13)4-8/h2-5H,15H2,1H3