175136-00-2 Usage
Uses
Used in Pharmaceutical Synthesis:
3-(2-CHLORO-3,4-DIMETHOXYPHENYL)PROP-2-ENOYL CHLORIDE is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a versatile building block in the creation of new medicinal compounds, contributing to the development of novel treatments and therapies.
Used in Agrochemical Production:
In the agrochemical industry, 3-(2-CHLORO-3,4-DIMETHOXYPHENYL)PROP-2-ENOYL CHLORIDE serves as an intermediate for the production of different agrochemicals. Its role in this sector is crucial for the development of new pesticides, herbicides, and other agricultural chemicals that can improve crop yields and protect plants from pests and diseases.
Used in Organic Compounds Synthesis:
3-(2-CHLORO-3,4-DIMETHOXYPHENYL)PROP-2-ENOYL CHLORIDE is also utilized as an intermediate in the synthesis of other organic compounds. Its reactivity and functional groups make it a valuable component in the production of specialty chemicals, fine chemicals, and other complex organic molecules for various applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-00-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175136-00:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*0)+(1*0)=122
122 % 10 = 2
So 175136-00-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H10Cl2O3/c1-15-8-5-3-7(4-6-9(12)14)10(13)11(8)16-2/h3-6H,1-2H3/b6-4+
