175136-02-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-3,4-dimethoxybenzamide is utilized as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure and reactivity contribute to the development of new therapeutic agents, enhancing the range of available medications and their efficacy.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2-Chloro-3,4-dimethoxybenzamide serves as a valuable compound for research and development. Its chemical properties and reactivity make it suitable for the creation of novel drug candidates, potentially leading to breakthroughs in the treatment of various diseases and conditions.
Used in Industrial Applications:
Beyond its pharmaceutical applications, 2-Chloro-3,4-dimethoxybenzamide may also find use in other industries due to its distinctive chemical characteristics. Its versatility and reactivity could be harnessed in the development of new materials, chemical processes, or other innovative applications where its unique properties can be leveraged to achieve desired outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-02-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175136-02:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*0)+(1*2)=124
124 % 10 = 4
So 175136-02-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H10ClNO3/c1-13-6-4-3-5(9(11)12)7(10)8(6)14-2/h3-4H,1-2H3,(H2,11,12)
