175136-11-5 Usage
Uses
Used in Pharmaceutical Industry:
2-[(7-METHYL-2,3-DIHYDRO-1H-INDEN-4-YL)OXY]PYRIDIN-3-AMINE is used as a potential active pharmaceutical ingredient for the development of new drugs due to its unique molecular structure and chemical properties.
Used in Agrochemical Industry:
2-[(7-METHYL-2,3-DIHYDRO-1H-INDEN-4-YL)OXY]PYRIDIN-3-AMINE is used as a potential component in agrochemical formulations for its possible pesticidal or herbicidal properties, which could be explored through further research.
Used in Materials Science:
2-[(7-METHYL-2,3-DIHYDRO-1H-INDEN-4-YL)OXY]PYRIDIN-3-AMINE is used as a potential building block in the synthesis of new materials with specific properties, such as in the development of advanced polymers or other functional materials, based on its chemical composition and structure.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-11-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175136-11:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*1)+(1*1)=125
125 % 10 = 5
So 175136-11-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2O/c1-10-7-8-14(12-5-2-4-11(10)12)18-15-13(16)6-3-9-17-15/h3,6-9H,2,4-5,16H2,1H3
