175136-12-6 Usage
Uses
Used in Pharmaceutical Industry:
4-ACETOXY-7-METHYLINDANE is used as a pharmaceutical intermediate for the synthesis of various drugs and chemical compounds. Its unique chemical structure and properties make it a valuable component in the development of new medications and pharmaceutical formulations.
As a chemical intermediate, 4-ACETOXY-7-METHYLINDANE plays a crucial role in the production of various pharmaceuticals, contributing to the advancement of medical treatments and therapies. Its potential applications in the pharmaceutical industry include the development of new drugs, improvement of existing medications, and the creation of novel chemical compounds with therapeutic properties. Proper safety procedures should be followed when working with 4-ACETOXY-7-METHYLINDANE to ensure the well-being of those involved in its synthesis and handling.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-12-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175136-12:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*1)+(1*2)=126
126 % 10 = 6
So 175136-12-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H14O2/c1-8-6-7-12(14-9(2)13)11-5-3-4-10(8)11/h6-7H,3-5H2,1-2H3
