175136-19-3 Usage
Uses
Used in Pharmaceutical Research:
3-(4-(4-Fluorobenzyl)oxy)phenyl)acrylic acid is used as a research compound for exploring its potential applications in the development of new pharmaceuticals. The presence of the fluoro group may confer unique properties to this molecule, making it a valuable candidate for further investigation in medicinal chemistry.
Used in Chemical Synthesis:
In the chemical synthesis industry, 3-(4-(4-Fluorobenzyl)oxy)phenyl)acrylic acid may be used as a building block or intermediate in the synthesis of more complex organic molecules. Its specific structure, including the fluoro group and aromatic rings, could be leveraged to create novel compounds with desired properties.
Used in Material Science:
3-(4-(4-Fluorobenzyl)oxy)phenyl)acrylic acid could also find applications in material science, where its unique molecular structure might be employed to develop new materials with specific characteristics. The fluoro group, in particular, could influence the material's properties, such as reactivity, stability, or solubility.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-19-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175136-19:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*1)+(1*9)=133
133 % 10 = 3
So 175136-19-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H13FO3/c17-14-6-1-13(2-7-14)11-20-15-8-3-12(4-9-15)5-10-16(18)19/h1-10H,11H2,(H,18,19)/b10-5+
