175136-24-0 Usage
Uses
Since the provided materials do not specify any particular applications for 4-(4-Fluorobenzyloxy)-3-nitroacetophenone, it is not possible to list its uses as per the given instructions. However, given its categorization as an organofluorine and its unique properties, it may have potential applications in the fields of pharmaceuticals and biochemical research, similar to other organofluorine compounds. Further studies and research would be required to determine its specific uses and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-24-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175136-24:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*2)+(1*4)=130
130 % 10 = 0
So 175136-24-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H12FNO4/c1-10(18)12-4-7-15(14(8-12)17(19)20)21-9-11-2-5-13(16)6-3-11/h2-8H,9H2,1H3