175136-39-7 Usage
Description
(7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-CHLOROPHENYL)METHANONE is a benzodioxin derivative chemical compound with a bromine-substituted ring and a chlorophenyl group attached to a methanone moiety. It is of interest in pharmaceutical research and drug development due to its potential pharmacological properties and biological activity.
Used in Pharmaceutical Research and Drug Development:
(7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-CHLOROPHENYL)METHANONE is used as a target for further investigation in the field of medicinal chemistry for its potential therapeutic applications. Its unique structure and specific functional groups make it a valuable building block for the synthesis of novel drug candidates targeting various biological pathways and disease targets.
Used in Medicinal Chemistry:
(7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-CHLOROPHENYL)METHANONE is used as a valuable building block for the synthesis of novel drug candidates targeting various biological pathways and disease targets due to its unique structure and specific functional groups.
Studies on this compound's pharmacokinetics, pharmacodynamics, and structure-activity relationship are essential for understanding its potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-39-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175136-39:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*3)+(1*9)=137
137 % 10 = 7
So 175136-39-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H10BrClO3/c16-12-8-14-13(19-5-6-20-14)7-11(12)15(18)9-1-3-10(17)4-2-9/h1-4,7-8H,5-6H2