175136-40-0 Usage
Uses
Used in Pharmaceutical Research and Development:
(7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-BROMOPHENYL)METHANONE is used as a potential drug candidate in pharmaceutical research and development. Its specific molecular structure and reactivity contribute to its potential as a therapeutic agent, offering new avenues for the treatment of various diseases and conditions.
Used in Organic Synthesis:
In the field of organic synthesis, (7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-BROMOPHENYL)METHANONE serves as a precursor in the synthesis of other complex organic compounds. Its unique properties allow for the creation of new molecules with diverse applications in various industries.
Used in Agrochemicals:
(7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-BROMOPHENYL)METHANONE is also utilized in the field of agrochemicals. Its molecular structure and reactivity make it a valuable component in the development of new pesticides, herbicides, and other agricultural chemicals, contributing to more effective and targeted crop protection.
Used in Specialty Chemicals Production:
In the production of specialty chemicals, (7-BROMO-2,3-DIHDRO-1,4-BENZODIOXIN-6-YL)(4-BROMOPHENYL)METHANONE is employed as a key building block. Its unique properties enable the creation of specialized chemicals for use in various industries, such as coatings, adhesives, and polymers, enhancing their performance and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-40-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175136-40:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*4)+(1*0)=130
130 % 10 = 0
So 175136-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H10Br2O3/c16-10-3-1-9(2-4-10)15(18)11-7-13-14(8-12(11)17)20-6-5-19-13/h1-4,7-8H,5-6H2
