175136-46-6 Usage
Uses
Used in Organic Synthesis:
(7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-NITROPHENYL)METHANONE is used as a synthetic intermediate for the preparation of various organic compounds. Its unique structure and reactivity make it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Research and Development:
In the pharmaceutical industry, (7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-NITROPHENYL)METHANONE is used as a potential candidate for the development of new drugs. Its chemical properties and structural features can be exploited to design and synthesize novel therapeutic agents with potential applications in various medical conditions.
Used in Agrochemical Research:
(7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-NITROPHENYL)METHANONE is also used in agrochemical research for the development of new pesticides and other agricultural chemicals. Its reactivity and structural features can be utilized to create compounds with improved efficacy and selectivity in controlling pests and diseases in crops.
Further research and studies are needed to explore the full potential and applications of this chemical compound in various industries. Its unique properties and reactivity make it a promising candidate for the development of innovative solutions in organic synthesis, pharmaceuticals, agrochemicals, and other related fields.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-46-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175136-46:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*4)+(1*6)=136
136 % 10 = 6
So 175136-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H10BrNO5/c16-12-8-14-13(21-5-6-22-14)7-11(12)15(18)9-1-3-10(4-2-9)17(19)20/h1-4,7-8H,5-6H2
