175136-70-6 Usage
Uses
Used in Organic Chemistry Research:
(2,3,4,5,6-PENTAMETHYLPHENYL)(2-THIENYL)METHANONE is used as a research compound in organic chemistry for studying its properties and potential applications.
Used in Pharmaceutical Industry:
(2,3,4,5,6-PENTAMETHYLPHENYL)(2-THIENYL)METHANONE is used as a chemical intermediate in the synthesis of pharmaceuticals for its potential therapeutic properties.
Used in Agrochemical Industry:
(2,3,4,5,6-PENTAMETHYLPHENYL)(2-THIENYL)METHANONE is used as a building block in the development of agrochemicals for its potential pesticidal or herbicidal properties.
Used in Materials Science:
(2,3,4,5,6-PENTAMETHYLPHENYL)(2-THIENYL)METHANONE is used in the development of new materials with specific properties, such as conductivity or stability, for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-70-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175136-70:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*7)+(1*0)=136
136 % 10 = 6
So 175136-70-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H18OS/c1-9-10(2)12(4)15(13(5)11(9)3)16(17)14-7-6-8-18-14/h6-8H,1-5H3
