175136-84-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Fluorobenzene-1,3-diacetonitrile is used as an intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and improving the efficacy of existing medications. Its unique chemical structure allows for the creation of novel compounds with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Fluorobenzene-1,3-diacetonitrile is used as a key intermediate in the production of pesticides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and diseases, thereby improving crop yields and food security.
Used in Dye Industry:
2-Fluorobenzene-1,3-diacetonitrile is utilized as a building block in the synthesis of dyes, which are essential for various applications such as textiles, printing, and coloring agents in different industries. Its unique properties enable the creation of dyes with improved colorfastness and performance characteristics.
Used in Chemical Industry:
As a versatile chemical intermediate, 2-Fluorobenzene-1,3-diacetonitrile is used in the synthesis of other important chemicals, expanding its applications across various sectors of the chemical industry. Its unique structure and properties make it a valuable component in the development of innovative products and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-84-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175136-84:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*8)+(1*4)=142
142 % 10 = 2
So 175136-84-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H10ClFO2/c13-10-2-1-3-11(14)12(10)7-4-8(15)6-9(16)5-7/h1-3,7H,4-6H2
