175137-18-5 Usage
Description
1-(4-CHLOROPHENYL)-5-PROPYL-1H-PYRAZOLE-4-CARBONYL CHLORIDE is a pyrazole derivative with the molecular formula C14H15ClN2O. It features a chloride group and a carbonyl chloride functional group, making it a versatile chemical compound for various applications.
Used in Pharmaceutical Industry:
1-(4-CHLOROPHENYL)-5-PROPYL-1H-PYRAZOLE-4-CARBONYL CHLORIDE is used as an intermediate in the synthesis of pharmaceuticals for its potential biological activity. It plays a crucial role in the production of various drugs, contributing to the development of new medications.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(4-CHLOROPHENYL)-5-PROPYL-1H-PYRAZOLE-4-CARBONYL CHLORIDE is used as an intermediate in the synthesis of pesticides. Its incorporation aids in the creation of effective pest control solutions, enhancing agricultural productivity.
Used in Organic Synthesis:
1-(4-CHLOROPHENYL)-5-PROPYL-1H-PYRAZOLE-4-CARBONYL CHLORIDE serves as a building block for the synthesis of more complex organic compounds. Its chemical structure makes it an important reagent in organic synthesis processes, facilitating the development of novel chemical entities.
Used in Drug Development:
As a key component in drug development, 1-(4-CHLOROPHENYL)-5-PROPYL-1H-PYRAZOLE-4-CARBONYL CHLORIDE is utilized in the design and synthesis of new pharmaceutical agents. Its unique properties allow researchers to explore its potential in creating innovative treatments and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-18-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 175137-18:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*1)+(1*8)=135
135 % 10 = 5
So 175137-18-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H12Cl2N2O/c1-2-3-12-11(13(15)18)8-16-17(12)10-6-4-9(14)5-7-10/h4-8H,2-3H2,1H3
175137-18-5Relevant articles and documents
BIPHENYLOXY-ACIDS
-
Page/Page column 65, (2008/06/13)
The present invention relates generally to substituted biphenyloxy acids (such as 4'-aryl-amido-biphenyl--4(3)-yloxy-acids and 4’-aryl-amidomethyl-biphenyl-4(3)-yloxy-acids) and methods of using them.