175137-22-1 Usage
Uses
Used in Organic Synthesis:
7-Methylthieno[3,2-d]pyrimidin-4-hydrazine is used as a building block in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for the formation of diverse chemical entities, contributing to the advancement of chemical research and development.
Used in Medicinal Chemistry:
In medicinal chemistry, 7-Methylthieno[3,2-d]pyrimidin-4-hydrazine is utilized as a key intermediate in the synthesis of pharmaceutical compounds. Its incorporation into drug molecules can potentially enhance their therapeutic properties, making it a valuable component in the development of new drugs.
Used in Pharmaceutical Research:
7-Methylthieno[3,2-d]pyrimidin-4-hydrazine is employed in pharmaceutical research for the exploration of its potential as a precursor to novel therapeutic agents. Its unique chemical structure may contribute to the discovery of new drugs with improved efficacy and selectivity.
Used in Materials Science:
In the field of materials science, 7-Methylthieno[3,2-d]pyrimidin-4-hydrazine may have potential applications in the development of new materials with specific properties. Its incorporation into material compositions could lead to advancements in areas such as polymers, coatings, and other material technologies.
Used in Agrochemicals:
7-Methylthieno[3,2-d]pyrimidin-4-hydrazine may also find use in the agrochemical industry, where it could be employed as a component in the development of new pesticides or other agricultural chemicals. Its unique structure and properties may contribute to the creation of more effective and environmentally friendly products.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-22-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175137-22:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*2)+(1*2)=131
131 % 10 = 1
So 175137-22-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4S/c1-4-2-12-6-5(4)9-3-10-7(6)11-8/h2-3H,8H2,1H3,(H,9,10,11)
