175137-41-4 Usage
Uses
Used in Pharmaceutical Industry:
METHYL 3-(2,5-DIMETHYL-1H-PYRROL-1-YL)-2-THIOPHENECARBOXYLATE is used as a key intermediate for the synthesis of various drugs. Its unique structure allows for the creation of complex organic molecules with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, METHYL 3-(2,5-DIMETHYL-1H-PYRROL-1-YL)-2-THIOPHENECARBOXYLATE is utilized as a building block for the development of pesticides. Its properties contribute to the formulation of effective and targeted agrochemical products.
Used in Fine Chemicals Production:
METHYL 3-(2,5-DIMETHYL-1H-PYRROL-1-YL)-2-THIOPHENECARBOXYLATE is also employed in the production of fine chemicals, where its distinctive structure and properties are leveraged to create high-quality specialty chemicals for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-41-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175137-41:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*4)+(1*1)=134
134 % 10 = 4
So 175137-41-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO2S/c1-8-4-5-9(2)13(8)10-6-7-16-11(10)12(14)15-3/h4-7H,1-3H3
