175137-55-0 Usage
Uses
Used in Pharmaceutical Industry:
2-(Cyclopropylcarbonyl)-3,3-di(methylthio)acrylonitrile is used as an intermediate for the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a key component in the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2-(Cyclopropylcarbonyl)-3,3-di(methylthio)acrylonitrile is used as an intermediate for the synthesis of various agrochemicals. Its properties make it suitable for the development of new pesticides and other agricultural chemicals that can help improve crop yields and protect plants from pests.
Used in Dye Industry:
2-(Cyclopropylcarbonyl)-3,3-di(methylthio)acrylonitrile is also used as an intermediate in the synthesis of dyestuff. Its chemical structure contributes to the development of new dyes with improved color properties and stability, which can be used in various applications such as textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-55-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 175137-55:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*5)+(1*5)=140
140 % 10 = 0
So 175137-55-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NOS2/c1-12-9(13-2)7(5-10)8(11)6-3-4-6/h6H,3-4H2,1-2H3
