175137-58-3 Usage
Uses
Used in Medicinal Chemistry:
4,7-DIMETHYLPYRAZOLO[5,1-C][1,2,4]TRIAZINE-3-CARBOXYLIC ACID is used as a chemical building block for the development of new pharmaceutical compounds. Its unique structure and potential biological activities make it a valuable component in the design and synthesis of novel drugs with specific therapeutic targets.
Used in Drug Development:
4,7-DIMETHYLPYRAZOLO[5,1-C][1,2,4]TRIAZINE-3-CARBOXYLIC ACID is used as a lead compound in drug discovery and development. Its potential pharmacological properties and interactions with biological targets can be further optimized and modified to develop effective therapeutic agents for various diseases and conditions.
Used in Chemical Research:
4,7-DIMETHYLPYRAZOLO[5,1-C][1,2,4]TRIAZINE-3-CARBOXYLIC ACID is used as a subject of study in chemical research to understand its properties, reactivity, and potential applications. Researchers can investigate its chemical behavior, interactions with other molecules, and its role in various chemical and biological processes.
Used in Biological Studies:
4,7-DIMETHYLPYRAZOLO[5,1-C][1,2,4]TRIAZINE-3-CARBOXYLIC ACID is used in biological studies to explore its potential biological activities and interactions with biological systems. This can help in understanding its mechanism of action, potential therapeutic effects, and possible side effects, which are crucial for its application in drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-58-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 175137-58:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*5)+(1*8)=143
143 % 10 = 3
So 175137-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N4O2/c1-4-3-6-9-10-7(8(13)14)5(2)12(6)11-4/h3H,1-2H3,(H,13,14)
