175137-59-4 Usage
Uses
Used in Organic Synthesis:
2-(4-BROMO-3,5-DIMETHYL-1H-PYRAZOL-1-YL)ACETONITRILE is used as a building block for the synthesis of various organic compounds due to its unique structure and functional groups.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-(4-BROMO-3,5-DIMETHYL-1H-PYRAZOL-1-YL)ACETONITRILE is used as a key intermediate in the development of new pharmaceuticals. Its potential biological activity and structural features make it a valuable candidate for medicinal chemistry research.
Used in Medicinal Chemistry Research:
2-(4-BROMO-3,5-DIMETHYL-1H-PYRAZOL-1-YL)ACETONITRILE is used as a starting material for the design and synthesis of novel compounds with potential therapeutic applications. Its versatility and the presence of a bromine atom allow for further functionalization and optimization of its properties.
Overall, 2-(4-BROMO-3,5-DIMETHYL-1H-PYRAZOL-1-YL)ACETONITRILE is a valuable compound in the fields of organic synthesis, pharmaceutical research, and medicinal chemistry due to its unique structure, functional groups, and potential applications in the development of new organic compounds and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-59-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175137-59:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*5)+(1*9)=144
144 % 10 = 4
So 175137-59-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H8BrN3/c1-5-7(8)6(2)11(10-5)4-3-9/h4H2,1-2H3
