175137-64-1 Usage
Uses
Used in Pharmaceutical Research and Development:
1-(4,7-DIMETHYLPYRAZOLO[5,1-C][1,2,4]TRIAZIN-3-YL)ETHAN-1-ONE is used as a chemical intermediate for the synthesis of various pharmaceutical drugs. Its unique structure and potential biological activities make it a valuable compound for exploring new drug candidates and developing novel therapeutic agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-(4,7-DIMETHYLPYRAZOLO[5,1-C][1,2,4]TRIAZIN-3-YL)ETHAN-1-ONE is used as a key building block for designing and synthesizing new molecules with potential therapeutic applications. Its versatility in chemical reactions allows researchers to create a wide range of compounds with diverse pharmacological properties.
Used in Drug Discovery:
1-(4,7-DIMETHYLPYRAZOLO[5,1-C][1,2,4]TRIAZIN-3-YL)ETHAN-1-ONE is used as a starting material in drug discovery processes. Its unique chemical structure and potential interactions with biological targets make it an attractive candidate for identifying new drugs with improved efficacy and safety profiles.
Used in Biological Research:
In biological research, 1-(4,7-DIMETHYLPYRAZOLO[5,1-C][1,2,4]TRIAZIN-3-YL)ETHAN-1-ONE may be used as a tool compound to study various biological processes and pathways. Its potential biological activities can help researchers gain insights into the mechanisms of disease and develop targeted therapeutic strategies.
Used in Chemical Synthesis:
1-(4,7-DIMETHYLPYRAZOLO[5,1-C][1,2,4]TRIAZIN-3-YL)ETHAN-1-ONE is used as a versatile building block in chemical synthesis, allowing researchers to create a variety of complex molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-64-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175137-64:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*6)+(1*4)=141
141 % 10 = 1
So 175137-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N4O/c1-5-4-8-10-11-9(7(3)14)6(2)13(8)12-5/h4H,1-3H3
