17518-49-9 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(2,6-Dichlorophenyl)ethanethioamide is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to modulate biological activity. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Production:
In the agrochemical industry, 2-(2,6-Dichlorophenyl)ethanethioamide serves as a crucial component in the production of pesticides and other crop protection agents. Its chemical properties contribute to the effectiveness of these products in managing pests and diseases, thereby enhancing crop yields and quality.
Used in Medicinal Chemistry Research:
2-(2,6-Dichlorophenyl)ethanethioamide is utilized as a research compound in medicinal chemistry, where it aids in the exploration of novel drug targets and the development of innovative therapeutic agents. Its unique structure provides a foundation for designing molecules with enhanced biological activity and selectivity.
Used in Drug Discovery:
As a potential modulator of biological activity, 2-(2,6-Dichlorophenyl)ethanethioamide plays a significant role in drug discovery. Its incorporation into drug candidates can lead to the identification of new treatments for various diseases and conditions, offering hope for improved patient outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 17518-49-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,5,1 and 8 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 17518-49:
(7*1)+(6*7)+(5*5)+(4*1)+(3*8)+(2*4)+(1*9)=119
119 % 10 = 9
So 17518-49-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H7Cl2NS/c9-6-2-1-3-7(10)5(6)4-8(11)12/h1-3H,4H2,(H2,11,12)
