175201-66-8 Usage
Amino acid derivative
Cysteine derivative The compound is derived from the naturally occurring amino acid cysteine, which is important for the structure and function of proteins in the body.
Thioether groups
Ethylthio and methylthio The compound contains both an ethylthio (S-ethyl) and a methylthio (S-methyl) group, which are sulfur-containing functional groups that can influence the compound's properties and interactions with biological systems.
Potential applications
Medicinal and pharmaceutical fields Due to its ability to interact with biological systems, the compound has potential applications in the development of therapeutic agents for various medical conditions.
Research interest
Structure and properties The unique structure and properties of the compound make it an interesting molecule for further research, which could lead to the development of new drugs and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 175201-66-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 1 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175201-66:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*1)+(2*6)+(1*6)=118
118 % 10 = 8
So 175201-66-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H18N2O3S2/c1-3-20-12-9(5-4-7-14-12)11(16)15-10(13(17)18)6-8-19-2/h4-5,7,10H,3,6,8H2,1-2H3,(H,15,16)(H,17,18)
