175202-00-3 Usage
Uses
Used in Pharmaceutical Industry:
6-HYDRAZINO-1,3,4-TRIMETHYL-1H-PYRAZOLO[3,4-B]PYRIDINE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be a potential candidate for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 6-HYDRAZINO-1,3,4-TRIMETHYL-1H-PYRAZOLO[3,4-B]PYRIDINE is utilized as a building block for the creation of novel agrochemicals. Its properties may contribute to the development of pesticides or other agricultural chemicals that can improve crop protection and yield.
Used in Research and Development:
6-HYDRAZINO-1,3,4-TRIMETHYL-1H-PYRAZOLO[3,4-B]PYRIDINE serves as a valuable compound in research and development labs. It is used for studying its chemical properties, reactivity, and potential interactions with biological systems, which can lead to the discovery of new applications and uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 175202-00-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 2 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175202-00:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*2)+(2*0)+(1*0)=103
103 % 10 = 3
So 175202-00-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H13N5/c1-5-4-7(12-10)11-9-8(5)6(2)13-14(9)3/h4H,10H2,1-3H3,(H,11,12)
