175202-60-5 Usage
Uses
Used in Organic Synthesis:
(3,4-DIMETHYLTHIENO[2,3-B]THIOPHEN-2-YL)METHANOL is used as a building block in organic synthesis for the creation of novel compounds with potential applications in various industries. Its unique structure allows for the formation of new chemical entities through reactions with other molecules, expanding the scope of organic chemistry.
Used in Material Science:
In the field of material science, (3,4-DIMETHYLTHIENO[2,3-B]THIOPHEN-2-YL)METHANOL is used as a component in the development of advanced materials. Its incorporation into polymers or other materials can potentially enhance their properties, such as electrical conductivity, stability, or mechanical strength, depending on the specific application.
Used in Pharmaceutical Research:
(3,4-DIMETHYLTHIENO[2,3-B]THIOPHEN-2-YL)METHANOL is utilized as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its unique structural properties may contribute to the development of new drugs with improved efficacy, selectivity, or reduced side effects. Further research is required to explore its potential in drug discovery and medicinal chemistry.
Used in Chemical Research:
In the realm of chemical research, (3,4-DIMETHYLTHIENO[2,3-B]THIOPHEN-2-YL)METHANOL serves as a subject of study to understand its reactivity, stability, and interactions with other molecules. This knowledge can contribute to the advancement of chemical science and the discovery of new reaction mechanisms or synthetic routes.
Check Digit Verification of cas no
The CAS Registry Mumber 175202-60-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 2 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175202-60:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*2)+(2*6)+(1*0)=115
115 % 10 = 5
So 175202-60-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H10OS2/c1-5-4-11-9-8(5)6(2)7(3-10)12-9/h4,10H,3H2,1-2H3
