175202-63-8 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
3-METHYL-5-(METHYLTHIO)-4-VINYLTHIOPHENE-2-CARBOXYLIC ACID is used as a key intermediate in the synthesis of pharmaceuticals and agrochemicals due to its unique structure and reactivity. Its presence in these industries is crucial for the development of new drugs and pesticides.
Used in Organic Electronic Materials Production:
3-METHYL-5-(METHYLTHIO)-4-VINYLTHIOPHENE-2-CARBOXYLIC ACID is used as a precursor in the production of organic electronic materials, such as organic solar cells and organic light-emitting diodes (OLEDs). Its unique properties contribute to the performance and efficiency of these materials.
Used in Dyes Production:
3-METHYL-5-(METHYLTHIO)-4-VINYLTHIOPHENE-2-CARBOXYLIC ACID is used as a starting material in the synthesis of various dyes. Its versatile chemical structure allows for the creation of dyes with different colors and properties, making it valuable in the dye industry.
Used in Organic Compounds Synthesis:
3-METHYL-5-(METHYLTHIO)-4-VINYLTHIOPHENE-2-CARBOXYLIC ACID is used as a precursor in the synthesis of various organic compounds. Its carboxylic acid group makes it acidic in nature, allowing it to participate in a wide range of chemical reactions, contributing to the formation of new compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175202-63-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175202-63:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*2)+(2*6)+(1*3)=118
118 % 10 = 8
So 175202-63-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H10O2S2/c1-4-6-5(2)7(8(10)11)13-9(6)12-3/h4H,1H2,2-3H3,(H,10,11)
