175202-81-0 Usage
Uses
Used in Pharmaceutical Development:
N-HYDROXY-2-(3-OXO-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-2-YL)ACETAMIDE is used as a chemical intermediate for the development of pharmaceuticals due to its potential pharmacological properties. Its unique structure, including the 1,4-benzothiazine core and functional groups, may contribute to its activity in treating specific medical conditions.
Used in Research and Development:
In the field of scientific research, N-HYDROXY-2-(3-OXO-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-2-YL)ACETAMIDE serves as a valuable compound for studying its chemical and biological properties. Researchers may investigate its interactions with biological targets, its metabolic pathways, and its potential toxicity to better understand how it can be applied in drug development.
Used in Drug Discovery:
N-HYDROXY-2-(3-OXO-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-2-YL)ACETAMIDE is used as a lead compound in drug discovery processes. Its structural features may be optimized through medicinal chemistry to enhance its potency, selectivity, and pharmacokinetic properties, making it a promising candidate for further development into a therapeutic agent.
Check Digit Verification of cas no
The CAS Registry Mumber 175202-81-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 2 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175202-81:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*2)+(2*8)+(1*1)=120
120 % 10 = 0
So 175202-81-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O3S/c13-9(12-15)5-8-10(14)11-6-3-1-2-4-7(6)16-8/h1-4,8,15H,5H2,(H,11,14)(H,12,13)
