175202-84-3 Usage
Uses
Used in Pharmaceutical Synthesis:
5-[(4-BROMO-3,5-DIMETHYL-1H-PYRAZOL-1-YL)METHYL]-1,3,4-OXADIAZOLE-2-THIOL is used as a building block in the synthesis of pharmaceuticals. Its unique structure and chemical properties make it a valuable intermediate in the development of new drugs, particularly in the fields of medicinal chemistry and pharmaceutical research.
Used in Agrochemical Synthesis:
In the agrochemical industry, 5-[(4-BROMO-3,5-DIMETHYL-1H-PYRAZOL-1-YL)METHYL]-1,3,4-OXADIAZOLE-2-THIOL is utilized as a key intermediate in the synthesis of various agrochemicals. Its presence in these compounds can contribute to the development of effective and innovative products for agricultural applications.
Further Research and Exploration:
Due to its unique structure and properties, 5-[(4-BROMO-3,5-DIMETHYL-1H-PYRAZOL-1-YL)METHYL]-1,3,4-OXADIAZOLE-2-THIOL has potential applications in other fields of chemistry and research. Further studies and research are necessary to explore its full range of potential uses and properties, which may lead to the discovery of new applications and advancements in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 175202-84-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 2 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175202-84:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*2)+(2*8)+(1*4)=123
123 % 10 = 3
So 175202-84-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BrN4OS/c1-4-7(9)5(2)13(12-4)3-6-10-11-8(15)14-6/h3H2,1-2H3,(H,11,15)
Xi:Irritant;
