175203-15-3 Usage
Uses
Used in Pharmaceutical Industry:
2-[5-(2-CHLOROACETYL)-2-THIENYL]ACETIC ACID is used as a pharmaceutical candidate for the development of drugs targeting various diseases. Its unique structure and properties allow it to interact with biological targets and modulate their functions, making it a valuable component in drug discovery and design.
Used in Chemical Synthesis:
2-[5-(2-CHLOROACETYL)-2-THIENYL]ACETIC ACID is used as a reagent in chemical synthesis processes. Its functional groups, such as the chloroacetyl and acetic acid groups, can be utilized in various chemical reactions to produce a range of compounds with different applications.
Used in Research and Development:
2-[5-(2-CHLOROACETYL)-2-THIENYL]ACETIC ACID is used in research and development for studying its potential biological activities and exploring its applications in various fields. Researchers can investigate its interactions with biological targets, evaluate its efficacy in disease models, and optimize its properties for specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175203-15-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 3 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 175203-15:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*3)+(2*1)+(1*5)=113
113 % 10 = 3
So 175203-15-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClO3S/c9-4-6(10)7-2-1-5(13-7)3-8(11)12/h1-2H,3-4H2,(H,11,12)
C:Corrosive;
