175203-16-4 Usage
Uses
Used in Chemical Industry:
2-[(2,6-Dichlorobenzyl)oxy]benzaldehyde is used as a chemical intermediate for the production of dyes, resins, pharmaceuticals, and aroma compounds. Its electrophilic properties may contribute to the synthesis of various chemical products.
Used in Pharmaceutical Industry:
2-[(2,6-Dichlorobenzyl)oxy]benzaldehyde is used as a building block in the synthesis of pharmaceutical compounds. Its unique structure and reactivity may enable the development of new drugs with potential therapeutic applications.
Used in Aroma Industry:
2-[(2,6-Dichlorobenzyl)oxy]benzaldehyde is used as a fragrance ingredient in the production of perfumes and other scented products. Its aromatic properties may contribute to the creation of unique and complex scents.
Note: Detailed understanding of this specific chemical would require further research and experimentation, as its specific uses, toxicity, physiological impacts, and applications are not widely documented in available literature.
Check Digit Verification of cas no
The CAS Registry Mumber 175203-16-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 3 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175203-16:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*3)+(2*1)+(1*6)=114
114 % 10 = 4
So 175203-16-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H10Cl2O2/c15-12-5-3-6-13(16)11(12)9-18-14-7-2-1-4-10(14)8-17/h1-8H,9H2
