175203-19-7 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-BROMO-4,6-DIFLUOROPHENOXY)-2-CHLOROETHANE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(2-BROMO-4,6-DIFLUOROPHENOXY)-2-CHLOROETHANE serves as a precursor in the production of agrochemicals. Its incorporation into these compounds can enhance their effectiveness in agricultural applications, such as pest control and crop protection.
Used in Organic Synthesis:
1-(2-BROMO-4,6-DIFLUOROPHENOXY)-2-CHLOROETHANE is utilized as a building block in the synthesis of other organic compounds. Its presence in these compounds can impart specific properties, such as increased stability or reactivity, making it a valuable component in the creation of novel organic materials.
Overall, the diverse applications of 1-(2-BROMO-4,6-DIFLUOROPHENOXY)-2-CHLOROETHANE across various industries highlight its importance as a versatile chemical compound with significant potential for further development and utilization.
Check Digit Verification of cas no
The CAS Registry Mumber 175203-19-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 3 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175203-19:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*3)+(2*1)+(1*9)=117
117 % 10 = 7
So 175203-19-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H6BrClF2O/c9-6-3-5(11)4-7(12)8(6)13-2-1-10/h3-4H,1-2H2
