175203-32-4 Usage
Uses
Used in Pharmaceutical Industry:
3-[(([1-(3,4-DICHLOROPHENYL)ETHYLIDENE]AMINO)OXY)METHYL]BENZOIC ACID is used as a potential active pharmaceutical ingredient for the development of new drugs due to its unique structural features and multifunctional groups that can interact with biological targets.
Used in Organic Synthesis:
In the field of organic synthesis, 3-[(([1-(3,4-DICHLOROPHENYL)ETHYLIDENE]AMINO)OXY)METHYL]BENZOIC ACID serves as a versatile building block or intermediate for the synthesis of more complex organic compounds, leveraging its reactive functional groups for further chemical transformations.
Used as a Research Tool in Medicinal Chemistry:
3-[(([1-(3,4-DICHLOROPHENYL)ETHYLIDENE]AMINO)OXY)METHYL]BENZOIC ACID is utilized as a research tool in medicinal chemistry to explore its interactions with biological systems, understand its pharmacological properties, and evaluate its potential as a lead compound for drug discovery.
Further research is necessary to fully elucidate the compound's properties, optimize its synthesis, and determine its specific applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 175203-32-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 3 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175203-32:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*3)+(2*3)+(1*2)=114
114 % 10 = 4
So 175203-32-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H13Cl2NO3/c1-10(12-5-6-14(17)15(18)8-12)19-22-9-11-3-2-4-13(7-11)16(20)21/h2-8H,9H2,1H3,(H,20,21)
