175203-52-8 Usage
Uses
Used in Pharmaceutical Industry:
1,4-DIMETHYLPIPERAZINE-2-CARBOHYDRAZIDE is used as a chemical intermediate for the synthesis of various pharmaceutical drugs. Its unique structure allows for the creation of a wide range of compounds with diverse therapeutic properties.
Used in Antitubercular Applications:
1,4-DIMETHYLPIPERAZINE-2-CARBOHYDRAZIDE is used as a potential antitubercular agent, exhibiting inhibitory activity against Mycobacterium tuberculosis. Its ability to target and inhibit the growth of this pathogen makes it a promising candidate for the development of new treatments for tuberculosis.
Used in Organic Synthesis:
1,4-DIMETHYLPIPERAZINE-2-CARBOHYDRAZIDE is used as a reagent in organic synthesis, facilitating the production of various organic compounds. Its versatility as a building block allows for the creation of a broad spectrum of chemical entities for research and industrial applications.
Used in Corrosion Inhibition:
1,4-DIMETHYLPIPERAZINE-2-CARBOHYDRAZIDE has been studied for its potential as a corrosion inhibitor. Its ability to protect materials from degradation and corrosion makes it a valuable asset in various industries, including manufacturing and construction.
Used in Anti-Inflammatory Applications:
1,4-DIMETHYLPIPERAZINE-2-CARBOHYDRAZIDE has been researched for its potential as an anti-inflammatory agent. Its capacity to modulate inflammatory responses could lead to the development of new treatments for various inflammatory conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 175203-52-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175203-52:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*3)+(2*5)+(1*2)=118
118 % 10 = 8
So 175203-52-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H16N4O/c1-10-3-4-11(2)6(5-10)7(12)9-8/h6H,3-5,8H2,1-2H3,(H,9,12)
