175203-98-2 Usage
General Description
2-[(3-Methylbenzo[b]thiophen-2-yl)carbonyl]benzoic acid is a chemical compound with the molecular formula C19H14O3S. It is a benzothiophene derivative with a carboxylic acid group and a carbonyl group attached to a benzene ring. 2-[(3-METHYLBENZO[B]THIOPHEN-2-YL)CARBONYL]BENZOIC ACID is used in research and pharmaceutical development as a building block for the synthesis of various organic molecules. Its unique structure and functional groups make it a versatile intermediate for the production of pharmaceuticals, agrochemicals, and other organic compounds. Additionally, it may have potential biological activities and could be of interest in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 175203-98-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 175203-98:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*3)+(2*9)+(1*8)=132
132 % 10 = 2
So 175203-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H12O3S/c1-10-11-6-4-5-9-14(11)21-16(10)15(18)12-7-2-3-8-13(12)17(19)20/h2-9H,1H3,(H,19,20)
