175204-26-9 Usage
Description
3,4-DI(PROPYLAMINO)CYCLOBUT-3-ENE-1,2-DIONE is a chemical compound with the molecular formula C10H15NO2. It is a cyclic diketone with propylamino groups attached to the 3 and 4 positions of the cyclobutene ring. 3,4-DI(PROPYLAMINO)CYCLOBUT-3-ENE-1,2-DIONE is utilized in organic synthesis and medicinal chemistry as a building block for the synthesis of various pharmaceuticals and bioactive molecules. Additionally, it has been studied for its potential pharmacological and biological activities. However, it is crucial to handle and use this compound with caution due to its potential hazardous properties and the necessity for proper safety precautions.
Uses
Used in Organic Synthesis:
3,4-DI(PROPYLAMINO)CYCLOBUT-3-ENE-1,2-DIONE is used as a building block in organic synthesis for the creation of various pharmaceuticals and bioactive molecules. Its unique structure allows for the development of new compounds with potential applications in medicine and other fields.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3,4-DI(PROPYLAMINO)CYCLOBUT-3-ENE-1,2-DIONE serves as a key component in the synthesis of pharmaceuticals. Its incorporation into drug molecules can lead to the discovery of new treatments and therapies for various diseases and conditions.
Used in Pharmaceutical Development:
3,4-DI(PROPYLAMINO)CYCLOBUT-3-ENE-1,2-DIONE is used as a starting material in the development of new pharmaceuticals. Its potential pharmacological and biological activities make it a valuable compound for research and development in the pharmaceutical industry.
Used in Research and Development:
3,4-DI(PROPYLAMINO)CYCLOBUT-3-ENE-1,2-DIONE is also utilized in research and development settings to explore its potential applications and properties. Studies on 3,4-DI(PROPYLAMINO)CYCLOBUT-3-ENE-1,2-DIONE can contribute to the advancement of knowledge in chemistry, medicine, and related fields.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-26-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175204-26:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*2)+(1*6)=119
119 % 10 = 9
So 175204-26-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N2O2/c1-3-5-11-7-8(12-6-4-2)10(14)9(7)13/h11-12H,3-6H2,1-2H3
