175204-53-2 Usage
Description
4-(METHYLTHIO)-6-(2-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE is a triazine derivative with the molecular formula C10H10N6S. It is a heterocyclic compound that features a six-membered ring with three nitrogen atoms. This chemical has potential applications in medicinal chemistry due to its possible biological activity, making it a candidate for the development of pharmaceutical drugs. Further research is required to fully understand its properties, uses, and effects on biological systems.
Uses
Used in Pharmaceutical Development:
4-(METHYLTHIO)-6-(2-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE is used as a chemical intermediate in the development of pharmaceutical drugs. Its unique structure and potential biological activity make it a promising candidate for creating new medications.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 4-(METHYLTHIO)-6-(2-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE serves as a subject for research to explore its potential interactions with biological targets. Understanding these interactions can lead to the discovery of new therapeutic agents.
Used in Drug Design and Synthesis:
4-(METHYLTHIO)-6-(2-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE is utilized in drug design and synthesis processes to create novel compounds with potential therapeutic effects. Its chemical properties allow for modifications and the development of new drug candidates.
Note: The specific applications and industries for 4-(METHYLTHIO)-6-(2-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE are not detailed in the provided materials. The uses listed above are inferred based on the general potential of triazine derivatives in medicinal chemistry and pharmaceutical development. Further information would be needed to provide more detailed applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-53-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175204-53:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*5)+(1*3)=122
122 % 10 = 2
So 175204-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N5S/c1-15-9-13-7(12-8(10)14-9)6-4-2-3-5-11-6/h2-5H,1H3,(H2,10,12,13,14)
