175204-61-2 Usage
Uses
Used in Pharmaceutical Industry:
4-(METHYLTHIO)-6-(2-THIENYL)-1,3,5-TRIAZIN-2-AMINE is used as a potential drug candidate for various therapeutic applications due to its ability to interact with biological targets or receptors. Its unique structure and functional groups may contribute to the development of new drugs with improved efficacy and safety profiles.
Used in Agrochemical Industry:
4-(METHYLTHIO)-6-(2-THIENYL)-1,3,5-TRIAZIN-2-AMINE is used as a potential pesticidal agent due to its structural features and functional groups. Further research and development on 4-(METHYLTHIO)-6-(2-THIENYL)-1,3,5-TRIAZIN-2-AMINE could lead to the discovery of new agrochemicals with enhanced efficacy and safety in controlling pests and diseases in agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-61-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175204-61:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*6)+(1*1)=122
122 % 10 = 2
So 175204-61-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N4S2/c1-13-8-11-6(10-7(9)12-8)5-3-2-4-14-5/h2-4H,1H3,(H2,9,10,11,12)
