175204-62-3 Usage
Uses
Used in Pharmaceutical Industry:
4-(methylthio)-6-(3-pyridyl)-1,3,5-triazin-2-amine is used as a potential therapeutic agent for various conditions due to its demonstrated anti-cancer, anti-inflammatory, and anti-bacterial properties. Its unique molecular structure allows it to interact with biological targets, offering new avenues for the treatment of diseases.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 4-(methylthio)-6-(3-pyridyl)-1,3,5-triazin-2-amine serves as a valuable compound for studying its structure-activity relationships and exploring its potential as a lead compound for drug development. Its diverse biological activities and pharmacological potential make it an interesting subject for further investigation and optimization to enhance its therapeutic efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-62-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175204-62:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*6)+(1*2)=123
123 % 10 = 3
So 175204-62-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N5S/c1-15-9-13-7(12-8(10)14-9)6-3-2-4-11-5-6/h2-5H,1H3,(H2,10,12,13,14)
