175204-63-4 Usage
Uses
Used in Agriculture:
4-(METHYLTHIO)-6-(4-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE is used as a selective herbicide for controlling a wide range of weeds in various crops. It is particularly effective in crops such as soybeans, potatoes, and sugarcane, where it helps to protect these plants from competition with unwanted weeds.
4-(METHYLTHIO)-6-(4-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE is used as a weed control agent for the following reasons:
It inhibits the photosynthesis process in weeds, leading to chlorosis, wilting, and eventual death, thereby reducing competition for nutrients and light.
It is absorbed by the roots and foliage of the target plants, ensuring effective control of the weeds.
Its selective nature allows it to be used in crops without causing harm to the desired plants, thus maintaining crop health and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-63-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175204-63:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*6)+(1*3)=124
124 % 10 = 4
So 175204-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N5S/c1-15-9-13-7(12-8(10)14-9)6-2-4-11-5-3-6/h2-5H,1H3,(H2,10,12,13,14)
