175204-64-5 Usage
Uses
Used in Medicinal Chemistry:
4-(METHYLTHIO)-6-TETRAHYDRO-1H-PYRROL-1-YL-1,3,5-TRIAZIN-2-AMINE is used as a potential pharmaceutical agent for the development of new drugs. Its unique molecular structure, featuring a triazine ring and a tetrahydro-1H-pyrrol-1-yl group, positions it as a candidate for various therapeutic applications, given the commonality of these groups in existing medicinal compounds.
Used in Research and Development:
In the field of chemical research, 4-(METHYLTHIO)-6-TETRAHYDRO-1H-PYRROL-1-YL-1,3,5-TRIAZIN-2-AMINE serves as a subject for investigation to explore its chemical properties, reactivity, and potential interactions with biological systems. Understanding these aspects can lead to the discovery of new applications and uses in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-64-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175204-64:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*6)+(1*4)=125
125 % 10 = 5
So 175204-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H13N5S/c1-14-8-11-6(9)10-7(12-8)13-4-2-3-5-13/h2-5H2,1H3,(H2,9,10,11,12)
