175204-69-0 Usage
Uses
Used in Medicinal Chemistry and Drug Development:
4-Hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine is used as a building block or intermediate in the synthesis of pharmaceutical compounds due to its unique structure and functional groups. Its hydrazino, pyridyl, and amine groups can be utilized in the development of new drugs with specific therapeutic properties.
Used in Organic Synthesis:
In the field of organic synthesis, 4-Hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine serves as a versatile precursor for the creation of various organic compounds. Its reactive functional groups can be modified or used in reactions to form new molecules with desired properties.
Used in Materials Science:
4-Hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine may have potential applications in materials science due to its unique structure and functional groups. It could be used in the development of new materials with specific properties, such as high thermal stability, chemical resistance, or other desirable characteristics.
Further research and studies are needed to fully understand the potential uses and properties of 4-Hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine and to explore its applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-69-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175204-69:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*6)+(1*9)=130
130 % 10 = 0
So 175204-69-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N7/c9-7-12-6(13-8(14-7)15-10)5-3-1-2-4-11-5/h1-4H,10H2,(H3,9,12,13,14,15)
