175204-70-3 Usage
Uses
Used in Pharmaceutical Industry:
4-HYDRAZINO-6-(3-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE is used as a key intermediate in the synthesis of pharmaceuticals for its potential to create biologically active molecules. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical field, 4-HYDRAZINO-6-(3-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE is utilized as a building block for the creation of agrochemicals, such as pesticides and herbicides, due to its reactivity and the ability to impart specific chemical activities.
Used in Materials Science:
4-HYDRAZINO-6-(3-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE is employed in materials science for the development of new materials with unique properties. Its chemical structure allows for the engineering of materials with specific characteristics for various applications.
Research is ongoing to further explore the potential applications of 4-HYDRAZINO-6-(3-PYRIDYL)-1,3,5-TRIAZIN-2-AMINE in different fields, leveraging its diverse properties and reactivity for innovative solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-70-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175204-70:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*7)+(1*0)=123
123 % 10 = 3
So 175204-70-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N7/c9-7-12-6(13-8(14-7)15-10)5-2-1-3-11-4-5/h1-4H,10H2,(H3,9,12,13,14,15)
