175204-93-0 Usage
Uses
Used in Pharmaceutical Industry:
4-BROMO-1-(3,4-DIMETHYLPHENYL)BUTAN-1-ONE is used as an intermediate in the synthesis of various pharmaceutical compounds for its unique structural properties that can be leveraged to create new drugs with specific therapeutic effects.
Used in Perfumery:
In the fragrance industry, 4-BROMO-1-(3,4-DIMETHYLPHENYL)BUTAN-1-ONE is used as a scent ingredient for its distinctive aromatic profile, contributing to the creation of unique and complex fragrances.
Used in Organic Synthesis:
4-BROMO-1-(3,4-DIMETHYLPHENYL)BUTAN-1-ONE is utilized as a reagent in organic synthesis for its ability to participate in various chemical reactions, facilitating the production of a wide range of organic compounds.
Used in Chemical Research:
As a component in chemical research, 4-BROMO-1-(3,4-DIMETHYLPHENYL)BUTAN-1-ONE is used to study and understand the properties and reactions of ketones, contributing to the advancement of organic chemistry knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-93-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175204-93:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*9)+(1*3)=130
130 % 10 = 0
So 175204-93-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H15BrO/c1-9-5-6-11(8-10(9)2)12(14)4-3-7-13/h5-6,8H,3-4,7H2,1-2H3
