175205-01-3 Usage
Uses
Used in Pharmaceutical Industry:
2-[(6-METHOXY-3-NITRO-2-PYRIDYL)THIO]PROPANOIC ACID is used as a synthetic intermediate for the development of drugs with various therapeutic purposes. Its unique chemical structure allows for the creation of pharmaceuticals that target a range of health conditions, leveraging its reactivity and functional groups to form complex molecular structures.
Used in Agrochemical Industry:
In the agrochemical sector, 2-[(6-METHOXY-3-NITRO-2-PYRIDYL)THIO]PROPANOIC ACID is utilized as a precursor in the synthesis of pesticides and herbicides. Its chemical properties make it suitable for the production of compounds that can effectively control, repel, or kill unwanted organisms in agricultural settings, thereby enhancing crop protection and yield.
While the provided materials do not specify other industries, the chemical properties of 2-[(6-METHOXY-3-NITRO-2-PYRIDYL)THIO]PROPANOIC ACID suggest potential applications in areas such as chemical research for the development of new materials, or in the synthesis of other specialty chemicals for various industrial uses. However, without additional context or data, these applications remain speculative.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-01-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175205-01:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*0)+(1*1)=113
113 % 10 = 3
So 175205-01-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O5S/c1-5(9(12)13)17-8-6(11(14)15)3-4-7(10-8)16-2/h3-5H,1-2H3,(H,12,13)
Xi:Irritant;
