175205-11-5 Usage
Uses
Used in Pharmaceutical Industry:
6-CHLORO-7-HYDROXY-4-(METHOXYMETHYL)-2H-CHROMEN-2-ONE is used as a potential pharmaceutical agent for its exhibited biological activity and medicinal properties. 6-CHLORO-7-HYDROXY-4-(METHOXYMETHYL)-2H-CHROMEN-2-ONE's unique structure, including the chloro, hydroxyl, and methoxymethyl groups, may contribute to its therapeutic effects and interactions with biological targets.
Further research is necessary to fully understand the compound's properties, mechanisms of action, and potential applications in treating specific diseases or conditions. As a synthetic compound, it may also be optimized for improved efficacy, safety, and pharmacokinetic profiles through medicinal chemistry approaches.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-11-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175205-11:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*1)+(1*1)=115
115 % 10 = 5
So 175205-11-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H9ClO4/c1-15-5-6-2-11(14)16-10-4-9(13)8(12)3-7(6)10/h2-4,13H,5H2,1H3
