175205-15-9 Usage
Uses
Used in Pharmaceutical Industry:
4-(4-bromo-2-chloroanilino)-4-oxobut-2-enoic acid is used as a potential active pharmaceutical ingredient for the development of new drugs. Its unique structure, including the presence of a benzene ring with halogen substituents and a carboxylic acid group, may offer opportunities for medicinal chemistry, such as enhancing drug-target interactions and modulating pharmacokinetic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(4-bromo-2-chloroanilino)-4-oxobut-2-enoic acid may serve as a precursor or intermediate in the synthesis of novel agrochemicals, such as herbicides, insecticides, or fungicides. Its chemical structure could be exploited to target specific pests or weeds, potentially leading to more effective and selective crop protection agents.
Used in Materials Science:
4-(4-bromo-2-chloroanilino)-4-oxobut-2-enoic acid could be utilized in the development of advanced materials for various applications within materials science. Its structural features, including the benzene ring, halogen atoms, and functional groups, may contribute to the creation of new polymers, coatings, or composites with tailored properties for specific uses.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-15-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 175205-15:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*1)+(1*5)=119
119 % 10 = 9
So 175205-15-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H7BrClNO3/c11-6-1-2-8(7(12)5-6)13-9(14)3-4-10(15)16/h1-5H,(H,13,14)(H,15,16)/b4-3+
