175205-16-0 Usage
Uses
Used in Pharmaceutical Industry:
N-(4-BROMO-2-METHYLPHENYL)MALEAMIC ACID is used as a building block for the synthesis of various organic molecules, contributing to the development of new pharmaceutical compounds. Its unique structure allows for the creation of molecules with specific therapeutic properties, potentially leading to advancements in drug discovery and medicinal chemistry.
Used in Materials Science:
In the field of materials science, N-(4-BROMO-2-METHYLPHENYL)MALEAMIC ACID is utilized as a component in the development of new materials with tailored properties. Its chemical structure can be manipulated to achieve desired characteristics, such as improved stability, reactivity, or selectivity, making it a valuable asset in the creation of innovative materials for various applications.
Safety Considerations:
It is crucial to handle N-(4-BROMO-2-METHYLPHENYL)MALEAMIC ACID with care, as it may present hazards if not properly managed. Due to its chemical nature, appropriate safety measures should be taken during its synthesis, storage, and use to minimize potential risks to human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-16-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175205-16:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*1)+(1*6)=120
120 % 10 = 0
So 175205-16-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H10BrNO3/c1-7-6-8(12)2-3-9(7)13-10(14)4-5-11(15)16/h2-6H,1H3,(H,13,14)(H,15,16)/p-1/b5-4-
