175205-19-3 Usage
Uses
Used in Pharmaceutical Industry:
4-BROMO-2-(2-NITROPROP-1-ENYL)THIOPHENE is used as a synthetic intermediate for the production of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 4-BROMO-2-(2-NITROPROP-1-ENYL)THIOPHENE is employed as a precursor in the synthesis of agrochemicals, contributing to the development of novel pesticides and other crop protection agents.
Used in Specialty Chemicals Industry:
4-BROMO-2-(2-NITROPROP-1-ENYL)THIOPHENE is utilized as a key building block in the synthesis of specialty chemicals, which are used in various applications such as dyes, fragrances, and other industrial processes.
Due to the complex structure and potential reactivity of 4-BROMO-2-(2-NITROPROP-1-ENYL)THIOPHENE, it is essential to handle and store 4-BROMO-2-(2-NITROPROP-1-ENYL)THIOPHENE with care to ensure safety and prevent any adverse effects.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-19-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175205-19:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*1)+(1*9)=123
123 % 10 = 3
So 175205-19-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrNO2S/c1-5(9(10)11)2-7-3-6(8)4-12-7/h2-4H,1H3/b5-2+
