175205-30-8 Usage
General Description
1-(4-ISOBUTYLPHENYL)-3-(3-NITROPHENYL)PROP-2-EN-1-ONE, also known as a nitroketone, is a chemical compound with a complex molecular structure. It is classified as an alpha, beta-unsaturated ketone and belongs to the family of organic compounds known as benzophenones. 1-(4-ISOBUTYLPHENYL)-3-(3-NITROPHENYL)PROP-2-EN-1-ONE is commonly used in the field of organic chemistry as a building block for the synthesis of various pharmaceuticals and other organic molecules. It exhibits notable chemical reactivity due to the presence of both a nitro group and an alpha, beta-unsaturated ketone moiety, making it a valuable intermediate in organic synthesis. Additionally, it has potential applications in materials science and drug development, owing to its unique structural properties.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175205-30:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*3)+(1*0)=118
118 % 10 = 8
So 175205-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H19NO3/c1-14(2)12-16-6-9-17(10-7-16)19(21)11-8-15-4-3-5-18(13-15)20(22)23/h3-11,13-14H,12H2,1-2H3/b11-8+
